Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2,5-Dichloro-Phenol Potassium Salt (1:1) |
|---|---|
| Synonyms | Phenol, 2,5-Dichloro-, Potassium Salt |
| Molecular Structure |  |
| Molecular Formula | C6H3Cl2KO |
| Molecular Weight | 201.09 |
| CAS Registry Number | 68938-81-8 |
| EINECS | 273-147-3 |
| SMILES | C1=C(C=CC(=C1[O-])Cl)Cl.[K+] |
| InChI | 1S/C6H4Cl2O.K/c7-4-1-2-5(8)6(9)3-4;/h1-3,9H;/q;+1/p-1 |
| InChIKey | OKTIHTLOYFRBTK-UHFFFAOYSA-M |
| Boiling point | 214.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 100°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dichloro-Phenol Potassium Salt (1:1) |