|
CAS#: 68958-61-2 Product: Poly(ethylene glycol) 2-[ethyl[(heptadecafluorooctyl)sulfonyl]amino]ethyl methy ether No suppilers available for the product. |
| Name | Poly(ethylene glycol) 2-[ethyl[(heptadecafluorooctyl)sulfonyl]amino]ethyl methy ether |
|---|---|
| Synonyms | Poly(Oxy-1,2-Ethanediyl), Alpha-(2-(Ethyl((Heptadecafluorooctyl)Sulfonyl)Amino)Ethyl)-Omega-Methoxy- |
| Molecular Formula | C15H16F17NO4S |
| Molecular Weight | 629.33 |
| CAS Registry Number | 68958-61-2 |
| SMILES | C(N(CCOCCOC)[S](=O)(=O)C(C(F)(F)C(C(C(C(F)(F)C(F)(F)C(F)(F)F)(F)F)(F)F)(F)F)(F)F)C |
| InChI | 1S/C15H16F17NO4S/c1-3-33(4-5-37-7-6-36-2)38(34,35)15(31,32)13(26,27)11(22,23)9(18,19)8(16,17)10(20,21)12(24,25)14(28,29)30/h3-7H2,1-2H3 |
| InChIKey | KZSBXFKHBIBCNS-UHFFFAOYSA-N |
| Density | 1.534g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.374°C at 760 mmHg (Cal.) |
| Flash point | 170.539°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Poly(ethylene glycol) 2-[ethyl[(heptadecafluorooctyl)sulfonyl]amino]ethyl methy ether |