|
CAS#: 68969-72-2 Product: 3,3-Dimethyl-1,2-Ditert-Butyl-Diphosphirane No suppilers available for the product. |
| Name | 3,3-Dimethyl-1,2-Ditert-Butyl-Diphosphirane |
|---|---|
| Synonyms | 1,2-Ditert-Butyl-3,3-Dimethyl-Diphosphirane; 1,2-Ditert-Butyl-3,3-Dimethyl-1,2-Diphosphirane; Diphosphirane, 1,2-Bis(1,1-Dimethylethyl)-3,3-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H24P2 |
| Molecular Weight | 218.26 |
| CAS Registry Number | 68969-72-2 |
| SMILES | CC1(P(P1C(C)(C)C)C(C)(C)C)C |
| InChI | 1S/C11H24P2/c1-9(2,3)12-11(7,8)13(12)10(4,5)6/h1-8H3 |
| InChIKey | DHWBVWDAPIYNGE-UHFFFAOYSA-N |
| Boiling point | 236.172°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 99.08°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Dimethyl-1,2-Ditert-Butyl-Diphosphirane |