|
CAS#: 68989-02-6 Product: Alkyl(C12-C16) Dimethyl 3,4-Dichlorobenzyl Ammonium Chloride No suppilers available for the product. |
| Name | Alkyl(C12-C16) Dimethyl 3,4-Dichlorobenzyl Ammonium Chloride |
|---|---|
| Synonyms | (2-Chloro-4,5-Dimethyl-Phenyl) N-Methylcarbamate; N-Methylcarbamic Acid (2-Chloro-4,5-Dimethylphenyl) Ester; N-Methylcarbamic Acid (2-Chloro-4,5-Dimethyl-Phenyl) Ester |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 |
| CAS Registry Number | 68989-02-6 |
| SMILES | C1=C(C(=CC(=C1OC(NC)=O)Cl)C)C |
| InChI | 1S/C10H12ClNO2/c1-6-4-8(11)9(5-7(6)2)14-10(13)12-3/h4-5H,1-3H3,(H,12,13) |
| InChIKey | QRTXZGIQTYDABO-UHFFFAOYSA-N |
| Density | 1.185g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.792°C at 760 mmHg (Cal.) |
| Flash point | 139.343°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Alkyl(C12-C16) Dimethyl 3,4-Dichlorobenzyl Ammonium Chloride |