|
CAS#: 68992-07-4 Product: [[[(Tetrahydrothiophene 1,1-Dioxide)-3-Yl]Imino]Bis(Methylene)]Bisphosphonic Acid No suppilers available for the product. |
| Name | [[[(Tetrahydrothiophene 1,1-Dioxide)-3-Yl]Imino]Bis(Methylene)]Bisphosphonic Acid |
|---|---|
| Synonyms | [(1,1-Dioxo-3-Thiolanyl)-(Phosphonomethyl)Amino]Methylphosphonic Acid; [(1,1-Diketothiolan-3-Yl)-(Phosphonomethyl)Amino]Methylphosphonic Acid; Phosphonic Acid, (((Tetrahydro-1,1-Dioxido-3-Thienyl)Imino)Bis(Methylene))Bis- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H15NO8P2S |
| Molecular Weight | 323.19 |
| CAS Registry Number | 68992-07-4 |
| SMILES | C(N(C1C[S](=O)(=O)CC1)C[P](=O)(O)O)[P](=O)(O)O |
| InChI | 1S/C6H15NO8P2S/c8-16(9,10)4-7(5-17(11,12)13)6-1-2-18(14,15)3-6/h6H,1-5H2,(H2,8,9,10)(H2,11,12,13) |
| InChIKey | BQIVITALMXDPBY-UHFFFAOYSA-N |
| Density | 1.811g/cm3 (Cal.) |
|---|---|
| Boiling point | 755.842°C at 760 mmHg (Cal.) |
| Flash point | 410.919°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [[[(Tetrahydrothiophene 1,1-Dioxide)-3-Yl]Imino]Bis(Methylene)]Bisphosphonic Acid |