|
CAS#: 69020-20-8 Product: 1,2,3,5,6,7-Hexahydro-2,2,6,6-Tetramethyl-2,6-Disila-S-Indacene No suppilers available for the product. |
| Name | 1,2,3,5,6,7-Hexahydro-2,2,6,6-Tetramethyl-2,6-Disila-S-Indacene |
|---|---|
| Synonyms | 2,6-Disila-S-Indacene,1,2,3,5,6,7-Hexahydro-2,2,6,6-Tetramethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22Si2 |
| Molecular Weight | 246.50 |
| CAS Registry Number | 69020-20-8 |
| SMILES | C1=C3C(=CC2=C1C[Si](C2)(C)C)C[Si](C3)(C)C |
| InChI | 1S/C14H22Si2/c1-15(2)7-11-5-13-9-16(3,4)10-14(13)6-12(11)8-15/h5-6H,7-10H2,1-4H3 |
| InChIKey | YLGDQINZVIURRM-UHFFFAOYSA-N |
| Density | 0.971g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.728°C at 760 mmHg (Cal.) |
| Flash point | 135.708°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,5,6,7-Hexahydro-2,2,6,6-Tetramethyl-2,6-Disila-S-Indacene |