|
CAS#: 6906-25-8 Product: N-[(3-Methylphenyl)Methylene]-Benzenamine No suppilers available for the product. |
| Name | N-[(3-Methylphenyl)Methylene]-Benzenamine |
|---|---|
| Synonyms | 1-(3-Methylphenyl)-N-Phenyl-Methanimine; (3-Methylbenzylidene)-Phenyl-Amine; Benzenamine, N-((3-Methylphenyl)Methylene)-, (E)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.26 |
| CAS Registry Number | 6906-25-8 |
| SMILES | C1=CC(=CC(=C1)C)C=NC2=CC=CC=C2 |
| InChI | 1S/C14H13N/c1-12-6-5-7-13(10-12)11-15-14-8-3-2-4-9-14/h2-11H,1H3 |
| InChIKey | PKKIGIFBWCPDLJ-UHFFFAOYSA-N |
| Density | 0.954g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.636°C at 760 mmHg (Cal.) |
| Flash point | 142.207°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(3-Methylphenyl)Methylene]-Benzenamine |