|
CAS#: 69095-83-6 Product: 3-(2-Ethylphenyl)-5-(3-methoxyphenyl)-1H-1,2,4-triazole No suppilers available for the product. |
| Name | 3-(2-Ethylphenyl)-5-(3-methoxyphenyl)-1H-1,2,4-triazole |
|---|---|
| Synonyms | Contragestazol; St-1959; (3-Ethylphenyl)-5-(3-Methoxyphenyl)-1,2,4-Triazole |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 |
| CAS Registry Number | 69095-83-6 |
| SMILES | C1=C(OC)C=CC=C1C2=N[NH]C(=N2)C3=C(C=CC=C3)CC |
| InChI | 1S/C17H17N3O/c1-3-12-7-4-5-10-15(12)17-18-16(19-20-17)13-8-6-9-14(11-13)21-2/h4-11H,3H2,1-2H3,(H,18,19,20) |
| InChIKey | GXCZZAKPGMYPDJ-UHFFFAOYSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.338°C at 760 mmHg (Cal.) |
| Flash point | 177.905°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Ethylphenyl)-5-(3-methoxyphenyl)-1H-1,2,4-triazole |