|
CAS#: 69120-17-8 Product: 1-Chloro-2-Ketohexanol-6-Phosphate No suppilers available for the product. |
| Name | 1-Chloro-2-Ketohexanol-6-Phosphate |
|---|---|
| Synonyms | (6-Chloro-5-Oxo-Hexyl) Dihydrogen Phosphate; (6-Chloro-5-Keto-Hexyl) Dihydrogen Phosphate; 1-Chloro-2-Ketohexanol-6-Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12ClO5P |
| Molecular Weight | 230.58 |
| CAS Registry Number | 69120-17-8 |
| SMILES | C(C(CCCCO[P](=O)(O)O)=O)Cl |
| InChI | 1S/C6H12ClO5P/c7-5-6(8)3-1-2-4-12-13(9,10)11/h1-5H2,(H2,9,10,11) |
| InChIKey | MRVPURQSDAPZES-UHFFFAOYSA-N |
| Density | 1.427g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.122°C at 760 mmHg (Cal.) |
| Flash point | 215.14°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-2-Ketohexanol-6-Phosphate |