|
CAS#: 6914-70-1 Product: Dimethyl (1R,2S)-1,2-Dimethyl-1,2-Cyclopropanedicarboxylate No suppilers available for the product. |
| Name | Dimethyl (1R,2S)-1,2-Dimethyl-1,2-Cyclopropanedicarboxylate |
|---|---|
| Synonyms | cis-1,2-Dimethylcyclopropanedicarboxylicaciddimer |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 |
| CAS Registry Number | 6914-70-1 |
| SMILES | O=C(OC)[C@@]1(C)C[C@@]1(C)C(=O)OC |
| InChI | 1S/C9H14O4/c1-8(6(10)12-3)5-9(8,2)7(11)13-4/h5H2,1-4H3/t8-,9+ |
| InChIKey | OALVQGVETNDHAP-DTORHVGOSA-N |
| Density | 1.126g/cm3 (Cal.) |
|---|---|
| Boiling point | 219.299°C at 760 mmHg (Cal.) |
| Flash point | 99.409°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl (1R,2S)-1,2-Dimethyl-1,2-Cyclopropanedicarboxylate |