|
CAS#: 69140-15-4 Product: 3-Hydroxycholest-8-En-7-One No suppilers available for the product. |
| Name | 3-Hydroxycholest-8-En-7-One |
|---|---|
| Synonyms | (3S,5R,10S,13R,14R)-17-[(1R)-1,5-Dimethylhexyl]-3-Hydroxy-10,13-Dimethyl-1,2,3,4,5,6,11,12,14,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-7-One; 3-Hceo; 3-Hydroxy-5Alpha-Cholest-8-En-7-One |
| Molecular Structure | ![]() |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.64 |
| CAS Registry Number | 69140-15-4 |
| SMILES | [C@H]12[C@@](C(CC1)[C@@H](CCCC(C)C)C)(CCC3=C2C(=O)C[C@@H]4[C@@]3(CC[C@H](O)C4)C)C |
| InChI | 1S/C27H44O2/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(28)15-19(26)16-24(25)29/h17-22,28H,6-16H2,1-5H3/t18-,19-,20+,21?,22+,26+,27-/m1/s1 |
| InChIKey | ZKZOFLZBQASYNQ-MXCCHVFPSA-N |
| Density | 1.034g/cm3 (Cal.) |
|---|---|
| Boiling point | 516.055°C at 760 mmHg (Cal.) |
| Flash point | 218.23°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxycholest-8-En-7-One |