|
CAS#: 69217-67-0 Product: 4-(Acetylamino)Phenyl N-Acetyl-DL-Methionate No suppilers available for the product. |
| Name | 4-(Acetylamino)Phenyl N-Acetyl-DL-Methionate |
|---|---|
| Synonyms | (4-Acetamidophenyl) (2S)-2-Acetamido-4-Methylsulfanyl-Butanoate; (2S)-2-Acetamido-4-(Methylthio)Butanoic Acid (4-Acetamidophenyl) Ester; (2S)-2-Acetamido-4-(Methylthio)Butyric Acid (4-Acetamidophenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.39 |
| CAS Registry Number | 69217-67-0 |
| EINECS | 273-914-2 |
| SMILES | [C@H](C(=O)OC1=CC=C(C=C1)NC(=O)C)(NC(=O)C)CCSC |
| InChI | 1S/C15H20N2O4S/c1-10(18)16-12-4-6-13(7-5-12)21-15(20)14(8-9-22-3)17-11(2)19/h4-7,14H,8-9H2,1-3H3,(H,16,18)(H,17,19)/t14-/m0/s1 |
| InChIKey | GDRGOYFISYGSHQ-AWEZNQCLSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 631.165°C at 760 mmHg (Cal.) |
| Flash point | 335.516°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Acetylamino)Phenyl N-Acetyl-DL-Methionate |