|
CAS#: 69226-64-8 Product: N-(2-Methoxyphenethyl)-N-Methylurea No suppilers available for the product. |
| Name | N-(2-Methoxyphenethyl)-N-Methylurea |
|---|---|
| Synonyms | 1-[2-(2-Methoxyphenyl)Ethyl]-1-Methyl-Urea; N-(2-Methoxyphenethyl)-N-Methylurea; Urea, N-(2-Methoxyphenethyl)-N-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 |
| CAS Registry Number | 69226-64-8 |
| SMILES | C1=C(C(=CC=C1)CCN(C(=O)N)C)OC |
| InChI | 1S/C11H16N2O2/c1-13(11(12)14)8-7-9-5-3-4-6-10(9)15-2/h3-6H,7-8H2,1-2H3,(H2,12,14) |
| InChIKey | MKLFBMJPUKRZRS-UHFFFAOYSA-N |
| Density | 1.112g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.773°C at 760 mmHg (Cal.) |
| Flash point | 159.289°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Methoxyphenethyl)-N-Methylurea |