Online Database of Chemicals from Around the World
|
CAS#: 69267-50-1 Product: 2-Nitro-Naphthol(1,2-b)Furan No suppilers available for the product. |
| Name | 2-Nitro-Naphthol(1,2-b)Furan |
|---|---|
| Synonyms | 2-Nitrobenzo[G]Benzofuran; 2-Nitronaphtho(1,2-B)Furan; 2-Nitronaphthol(1,2-B)Furan |
| Molecular Structure |  |
| Molecular Formula | C12H7NO3 |
| Molecular Weight | 213.19 |
| CAS Registry Number | 69267-50-1 |
| SMILES | C1=C(OC2=C3C(=CC=C12)C=CC=C3)[N+](=O)[O-] |
| InChI | 1S/C12H7NO3/c14-13(15)11-7-9-6-5-8-3-1-2-4-10(8)12(9)16-11/h1-7H |
| InChIKey | CTAXXPBHFYJMNA-UHFFFAOYSA-N |
| Density | 1.4g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.219°C at 760 mmHg (Cal.) |
| Flash point | 186.774°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitro-Naphthol(1,2-b)Furan |