Online Database of Chemicals from Around the World
|
CAS#: 69298-90-4 Product: 2,2,2-Trichloro-1-(2,2,2-Trichloro-1-Hydroxyethoxy)Ethyl Phosphonate No suppilers available for the product. |
| Name | 2,2,2-Trichloro-1-(2,2,2-Trichloro-1-Hydroxyethoxy)Ethyl Phosphonate |
|---|---|
| Synonyms | 2,2,2-Trichloro-1-(2,2,2-Trichloro-1-Dimethoxyphosphoryl-Ethoxy)Ethanol; (1-(1-Hydroxy-2,2,2-Trichloroethoxy)-2,2,2-Trichloroethyl)Phosphonic Acid, Dimethyl Ester; 2,2,2-Trichloro-1-(2,2,2-Trichloro-1-Hydroxyethoxy)Ethyl Phosphonate |
| Molecular Structure |  |
| Molecular Formula | C6H9Cl6O5P |
| Molecular Weight | 404.83 |
| CAS Registry Number | 69298-90-4 |
| SMILES | CO[P](=O)(OC)C(OC(C(Cl)(Cl)Cl)O)C(Cl)(Cl)Cl |
| InChI | 1S/C6H9Cl6O5P/c1-15-18(14,16-2)4(6(10,11)12)17-3(13)5(7,8)9/h3-4,13H,1-2H3 |
| InChIKey | HZGOLOSDLOADOX-UHFFFAOYSA-N |
| Density | 1.705g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.7°C at 760 mmHg (Cal.) |
| Flash point | 177.993°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Trichloro-1-(2,2,2-Trichloro-1-Hydroxyethoxy)Ethyl Phosphonate |