|
CAS#: 69352-46-1 Product: N'-[1-(4-Chlorophenyl)Ethyl]Acetohydrazide No suppilers available for the product. |
| Name | N'-[1-(4-Chlorophenyl)Ethyl]Acetohydrazide |
|---|---|
| Synonyms | N'-[1-(4-Chlorophenyl)Ethyl]Ethanehydrazide; Hydrazine, 1-Acetyl-2-(P-Chloro-Alpha-Methylbenzyl)-; 1-Acetyl-2-(P-Chloro-Alpha-Methylbenzyl)Hydrazine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 |
| CAS Registry Number | 69352-46-1 |
| SMILES | C1=CC(=CC=C1C(NNC(C)=O)C)Cl |
| InChI | 1S/C10H13ClN2O/c1-7(12-13-8(2)14)9-3-5-10(11)6-4-9/h3-7,12H,1-2H3,(H,13,14) |
| InChIKey | GSZBDDZFMYMZHN-UHFFFAOYSA-N |
| Density | 1.164g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.948°C at 760 mmHg (Cal.) |
| Flash point | 134.599°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N'-[1-(4-Chlorophenyl)Ethyl]Acetohydrazide |