|
CAS#: 69359-47-3 Product: 8-Ethyladenosine No suppilers available for the product. |
| Name | 8-Ethyladenosine |
|---|---|
| Synonyms | 2-(6-Amin |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.29 |
| CAS Registry Number | 69359-47-3 |
| SMILES | n2c1c(ncnc1n(c2CC)[C@@H]3O[C@@H]([C@@H](O)[C@H]3O)CO)N |
| InChI | 1S/C12H17N5O4/c1-2-6-16-7-10(13)14-4-15-11(7)17(6)12-9(20)8(19)5(3-18)21-12/h4-5,8-9,12,18-20H,2-3H2,1H3,(H2,13,14,15)/t5-,8-,9-,12-/m1/s1 |
| InChIKey | OOOZBXHUEHEQJT-JJNLEZRASA-N |
| Density | 1.852g/cm3 (Cal.) |
|---|---|
| Boiling point | 676.774°C at 760 mmHg (Cal.) |
| Flash point | 363.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Ethyladenosine |