|
CAS#: 69365-86-2 Product: 6-Propylbicyclo[2.2.1]Hept-2-Ene-6-Carboxamide No suppilers available for the product. |
| Name | 6-Propylbicyclo[2.2.1]Hept-2-Ene-6-Carboxamide |
|---|---|
| Synonyms | 6-Propyl-6-Bicyclo[2.2.1]Hept-2-Enecarboxamide; 2-Norbornene-5-Endo-Carboxamide, 5-Exo-Propyl-; 5-Exo-Propyl-2-Norbornene-5-Endo-Carboxamide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 |
| CAS Registry Number | 69365-86-2 |
| SMILES | C(C1(C2C=CC(C1)C2)C(=O)N)CC |
| InChI | 1S/C11H17NO/c1-2-5-11(10(12)13)7-8-3-4-9(11)6-8/h3-4,8-9H,2,5-7H2,1H3,(H2,12,13) |
| InChIKey | MNKMXANEIVDRFR-UHFFFAOYSA-N |
| Density | 1.058g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.308°C at 760 mmHg (Cal.) |
| Flash point | 150.541°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Propylbicyclo[2.2.1]Hept-2-Ene-6-Carboxamide |