|
CAS#: 6939-05-5 Product: 2-Chloro-7-Nitrofluorene No suppilers available for the product. |
| Name | 2-Chloro-7-Nitrofluorene |
|---|---|
| Synonyms | 2-Chloro-7-Nitrofluorene; 4-05-00-02151 (Beilstein Handbook Reference); Brn 1979585 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8ClNO2 |
| Molecular Weight | 245.66 |
| CAS Registry Number | 6939-05-5 |
| SMILES | C1=C([N+](=O)[O-])C=CC2=C1CC3=CC(=CC=C23)Cl |
| InChI | 1S/C13H8ClNO2/c14-10-1-3-12-8(6-10)5-9-7-11(15(16)17)2-4-13(9)12/h1-4,6-7H,5H2 |
| InChIKey | HJFWZNLUJDRROD-UHFFFAOYSA-N |
| Density | 1.427g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.868°C at 760 mmHg (Cal.) |
| Flash point | 202.286°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-7-Nitrofluorene |