|
CAS#: 69423-76-3 Product: O,O'-Diacetylhematoporphyrin No suppilers available for the product. |
| Name | O,O'-Diacetylhematoporphyrin |
|---|---|
| Synonyms | Dachp; Hematoporphyrin-7,12-Diacetate; O,O'-Diacetylhematoporphyrin |
| Molecular Structure | ![]() |
| Molecular Formula | C38H42N4O8 |
| Molecular Weight | 682.77 |
| CAS Registry Number | 69423-76-3 |
| SMILES | C(C1=C(C3=NC1=CC5=NC(=CC2=C(C(=C([NH]2)C=C4[NH]C(=C3)C(=C4C)C(OC(=O)C)C)C(OC(=O)C)C)C)C(=C5CCC(=O)O)C)C)CC(=O)O |
| InChI | 1S/C38H42N4O8/c1-17-25(9-11-35(45)46)31-16-32-26(10-12-36(47)48)18(2)28(40-32)14-33-38(22(6)50-24(8)44)20(4)30(42-33)15-34-37(21(5)49-23(7)43)19(3)29(41-34)13-27(17)39-31/h13-16,21-22,41-42H,9-12H2,1-8H3,(H,45,46)(H,47,48) |
| InChIKey | QHMIEWWCNLMBMZ-UHFFFAOYSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 1123.682°C at 760 mmHg (Cal.) |
| Flash point | 633.38°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O,O'-Diacetylhematoporphyrin |