|
CAS#: 69454-55-3 Product: 9-Dimethylamino-1H-Phenalen-1-One No suppilers available for the product. |
| Name | 9-Dimethylamino-1H-Phenalen-1-One |
|---|---|
| Synonyms | 9-Dimethylamino-1-Phenalenone; 1H-Phenalen-1-One, 9-Dimethylamino-; 1H-Phenalen-1-One,9-Dimethylamino- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27 |
| CAS Registry Number | 69454-55-3 |
| SMILES | C1=CC3=C2C(=C1N(C)C)C(=O)C=CC2=CC=C3 |
| InChI | 1S/C15H13NO/c1-16(2)12-8-6-10-4-3-5-11-7-9-13(17)15(12)14(10)11/h3-9H,1-2H3 |
| InChIKey | ZETUHJUPYNMKTC-UHFFFAOYSA-N |
| Density | 1.237g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.13°C at 760 mmHg (Cal.) |
| Flash point | 168.846°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Dimethylamino-1H-Phenalen-1-One |