Online Database of Chemicals from Around the World
|
CAS#: 69467-22-7 Product: 5,6-Bis(4-Chlorophenyl)-3-Methoxy-1,2,4-Triazine No suppilers available for the product. |
| Name | 5,6-Bis(4-Chlorophenyl)-3-Methoxy-1,2,4-Triazine |
|---|---|
| Synonyms | 5,6-Bis-(P-Chlorophenyl)-3-Methoxy-As-Triazine; Brn 0819149; As-Triazine, 5,6-Bis(P-Chlorophenyl)-3-Methoxy- |
| Molecular Structure |  |
| Molecular Formula | C16H11Cl2N3O |
| Molecular Weight | 332.19 |
| CAS Registry Number | 69467-22-7 |
| SMILES | C1=CC(=CC=C1C2=C(N=C(N=N2)OC)C3=CC=C(C=C3)Cl)Cl |
| InChI | 1S/C16H11Cl2N3O/c1-22-16-19-14(10-2-6-12(17)7-3-10)15(20-21-16)11-4-8-13(18)9-5-11/h2-9H,1H3 |
| InChIKey | OBABGBDDCPDKMV-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.152°C at 760 mmHg (Cal.) |
| Flash point | 236.325°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Bis(4-Chlorophenyl)-3-Methoxy-1,2,4-Triazine |