| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 6-Ethylideneoctahydro-5,8-Methano-2H-1-Benzopyran-2-One |
|---|---|
| Synonyms | 6- And 7-Ethylideneoctahydro-5,8-Methano-2H-1-Benzopyran-2-One; 9-Ethylidene-3-Oxatricyclo(6.2.1.02,7)Undecane-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 |
| CAS Registry Number | 69486-14-2 |
| SMILES | C\C=C/3C2C1C(OC(=O)CC1)C(C2)C3 |
| InChI | 1S/C12H16O2/c1-2-7-5-8-6-10(7)9-3-4-11(13)14-12(8)9/h2,8-10,12H,3-6H2,1H3/b7-2+ |
| InChIKey | LLVFKEOMLYDSGT-FARCUNLSSA-N |
| Density | 1.187g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.722°C at 760 mmHg (Cal.) |
| Flash point | 139.62°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Ethylideneoctahydro-5,8-Methano-2H-1-Benzopyran-2-One |