|
CAS#: 69506-79-2 Product: Isoamericanin A No suppilers available for the product. |
| Name | Isoamericanin A |
|---|---|
| Synonyms | (E)-3-[3-(3,4-Dihydroxyphenyl)-2-(Hydroxymethyl)-2,3-Dihydro-1,4-Benzodioxin-7-Yl]Prop-2-Enal; (E)-3-[3-(3,4-Dihydroxyphenyl)-2-Methylol-2,3-Dihydro-1,4-Benzodioxin-7-Yl]Acrolein; 3-[3-(3,4-Dihydroxyphenyl)-2-Methylol-2,3-Dihydro-1,4-Benzodioxin-7-Yl]Acrolein |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 |
| CAS Registry Number | 69506-79-2 |
| SMILES | C2=C1OC(C(OC1=CC=C2\C=C\C=O)C3=CC=C(O)C(=C3)O)CO |
| InChI | 1S/C18H16O6/c19-7-1-2-11-3-6-15-16(8-11)23-17(10-20)18(24-15)12-4-5-13(21)14(22)9-12/h1-9,17-18,20-22H,10H2/b2-1+ |
| InChIKey | NTXXGPYGMQQSML-OWOJBTEDSA-N |
| Density | 1.39g/cm3 (Cal.) |
|---|---|
| Boiling point | 600.547°C at 760 mmHg (Cal.) |
| Flash point | 222.777°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isoamericanin A |