|
CAS#: 69533-68-2 Product: 9,10-Dihydro-2,7-Dinitro-Phenanthrene No suppilers available for the product. |
| Name | 9,10-Dihydro-2,7-Dinitro-Phenanthrene |
|---|---|
| Synonyms | 2,7-Dinitro-9-10-Dihydrophenanthrene; 9,10-Dihydro-2,7-Dinitrophenanthrene; Brn 2151582 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 |
| CAS Registry Number | 69533-68-2 |
| SMILES | C3=C2C1=C(C=C([N+]([O-])=O)C=C1)CCC2=CC(=C3)[N+]([O-])=O |
| InChI | 1S/C14H10N2O4/c17-15(18)11-3-5-13-9(7-11)1-2-10-8-12(16(19)20)4-6-14(10)13/h3-8H,1-2H2 |
| InChIKey | ITOVIJSDNGFFNC-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.768°C at 760 mmHg (Cal.) |
| Flash point | 227.996°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,10-Dihydro-2,7-Dinitro-Phenanthrene |