|
CAS#: 6956-24-7 Product: 1-[4-(Dimethylamino)Phenyl]-3-Methylurea No suppilers available for the product. |
| Name | 1-[4-(Dimethylamino)Phenyl]-3-Methylurea |
|---|---|
| Synonyms | 1-(4-Dimethylaminophenyl)-3-Methyl-Urea; Urea, 1-[P-(Dimethylaminophenyl)]-3-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 |
| CAS Registry Number | 6956-24-7 |
| EINECS | 230-139-4 |
| SMILES | C1=C(NC(=O)NC)C=CC(=C1)N(C)C |
| InChI | 1S/C10H15N3O/c1-11-10(14)12-8-4-6-9(7-5-8)13(2)3/h4-7H,1-3H3,(H2,11,12,14) |
| InChIKey | YIEYUMZIUOPBII-UHFFFAOYSA-N |
| Density | 1.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.464°C at 760 mmHg (Cal.) |
| Flash point | 139.145°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[4-(Dimethylamino)Phenyl]-3-Methylurea |