|
CAS#: 6956-34-9 Product: N''-[(1E)-2-Benzylideneheptylidene]-N'''-[(1Z)-2-Benzylideneheptylidene]Thiocarbonohydrazide No suppilers available for the product. |
| Name | N''-[(1E)-2-Benzylideneheptylidene]-N'''-[(1Z)-2-Benzylideneheptylidene]Thiocarbonohydrazide |
|---|---|
| Synonyms | NSC65020 |
| Molecular Structure | ![]() |
| Molecular Formula | C29H38N4S |
| Molecular Weight | 474.70 |
| CAS Registry Number | 6956-34-9 |
| SMILES | S=C(N/N=C\C(=Cc1ccccc1)CCCCC)N\N=C\C(=Cc2ccccc2)CCCCC |
| InChI | 1S/C29H38N4S/c1-3-5-9-19-27(21-25-15-11-7-12-16-25)23-30-32-29(34)33-31-24-28(20-10-6-4-2)22-26-17-13-8-14-18-26/h7-8,11-18,21-24H,3-6,9-10,19-20H2,1-2H3,(H2,32,33,34)/b27-21?,28-22?,30-23-,31-24+ |
| InChIKey | LGNIKDPAZKTRIY-UVNQMBQPSA-N |
| Density | 1.015g/cm3 (Cal.) |
|---|---|
| Boiling point | 601.291°C at 760 mmHg (Cal.) |
| Flash point | 317.449°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N''-[(1E)-2-Benzylideneheptylidene]-N'''-[(1Z)-2-Benzylideneheptylidene]Thiocarbonohydrazide |