|
CAS#: 69582-32-7 Product: 3-(4-Chlorophenyl)-3-(dimethylamino)-2-methyl-1-isoindolinone No suppilers available for the product. |
| Name | 3-(4-Chlorophenyl)-3-(dimethylamino)-2-methyl-1-isoindolinone |
|---|---|
| Synonyms | 1H-Isoind |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.78 |
| CAS Registry Number | 69582-32-7 |
| SMILES | CN1C(=O)c2ccccc2C1(c3ccc(cc3)Cl)N(C)C |
| InChI | 1S/C17H17ClN2O/c1-19(2)17(12-8-10-13(18)11-9-12)15-7-5-4-6-14(15)16(21)20(17)3/h4-11H,1-3H3 |
| InChIKey | XVFLHIWTYGAGHK-UHFFFAOYSA-N |
| Density | 1.283g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.075°C at 760 mmHg (Cal.) |
| Flash point | 218.135°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Chlorophenyl)-3-(dimethylamino)-2-methyl-1-isoindolinone |