|
CAS#: 6959-86-0 Product: 10,13-Dimethyl-17-Sulfanyl-1,2,6,7,8,9,11,12,14,15,16,17-Dodecahydrocyclopenta[a]Phenanthren-3-One No suppilers available for the product. |
| Name | 10,13-Dimethyl-17-Sulfanyl-1,2,6,7,8,9,11,12,14,15,16,17-Dodecahydrocyclopenta[a]Phenanthren-3-One |
|---|---|
| Synonyms | 17-Mercapto-10,13-Dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-3-One; Nsc69535; Nciopen2_009944 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H28OS |
| Molecular Weight | 304.49 |
| CAS Registry Number | 6959-86-0 |
| SMILES | CC34C2C(C1C(C(S)CC1)(CC2)C)CCC3=CC(=O)CC4 |
| InChI | 1S/C19H28OS/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3 |
| InChIKey | UTCIDVRYIUGDKT-UHFFFAOYSA-N |
| Density | 1.112g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.072°C at 760 mmHg (Cal.) |
| Flash point | 215.714°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10,13-Dimethyl-17-Sulfanyl-1,2,6,7,8,9,11,12,14,15,16,17-Dodecahydrocyclopenta[a]Phenanthren-3-One |