|
CAS#: 69642-59-7 Product: N,N-Dimethyl-4-[2-(Methylsulfonyl)Ethenyl]-Benzenamine No suppilers available for the product. |
| Name | N,N-Dimethyl-4-[2-(Methylsulfonyl)Ethenyl]-Benzenamine |
|---|---|
| Synonyms | N,N-Dimethyl-4-[(E)-2-Methylsulfonylvinyl]Aniline; [4-[(E)-2-Mesylvinyl]Phenyl]-Dimethyl-Amine; Benzenamine, N,N-Dimethyl-4-(2-(Methylsulfonyl)Ethenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 |
| CAS Registry Number | 69642-59-7 |
| SMILES | C1=C(\C=C\[S](=O)(=O)C)C=CC(=C1)N(C)C |
| InChI | 1S/C11H15NO2S/c1-12(2)11-6-4-10(5-7-11)8-9-15(3,13)14/h4-9H,1-3H3/b9-8+ |
| InChIKey | YFEDTPMLDSGPMO-CMDGGOBGSA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.511°C at 760 mmHg (Cal.) |
| Flash point | 216.585°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-4-[2-(Methylsulfonyl)Ethenyl]-Benzenamine |