|
CAS#: 69651-45-2 Product: 3,4-Bis(3-hydroxy-2-isopropyl-3-methyl-1-buten-1-ylidene)-2,5-hexanedione No suppilers available for the product. |
| Name | 3,4-Bis(3-hydroxy-2-isopropyl-3-methyl-1-buten-1-ylidene)-2,5-hexanedione |
|---|---|
| Synonyms | 3,4-Bis(3 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.50 |
| CAS Registry Number | 69651-45-2 |
| SMILES | O=C(\C(=C=C(/C(O)(C)C)C(C)C)\C(=C=C(/C(C)C)C(O)(C)C)C(=O)C)C |
| InChI | 1S/C22H34O4/c1-13(2)19(21(7,8)25)11-17(15(5)23)18(16(6)24)12-20(14(3)4)22(9,10)26/h13-14,25-26H,1-10H3 |
| InChIKey | UXNZFOSZKISSPK-UHFFFAOYSA-N |
| Density | 0.992g/cm3 (Cal.) |
|---|---|
| Boiling point | 538.514°C at 760 mmHg (Cal.) |
| Flash point | 293.552°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Bis(3-hydroxy-2-isopropyl-3-methyl-1-buten-1-ylidene)-2,5-hexanedione |