|
CAS#: 69658-17-9 Product: 3,9-Dihydroxy-7H-Benz[de]Anthracen-7-One No suppilers available for the product. |
| Name | 3,9-Dihydroxy-7H-Benz[de]Anthracen-7-One |
|---|---|
| Synonyms | 3,9-Dihydroxy-7H-Benz(De)Anthracen-7-One; 3,9-Dihydroxy-Benzanthrone; 7H-Benz(De)Anthracen-7-One, 3,9-Dihydroxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H10O3 |
| Molecular Weight | 262.26 |
| CAS Registry Number | 69658-17-9 |
| SMILES | C1=CC3=C2C(=C1O)C=CC=C2C(=O)C4=C3C=CC(=C4)O |
| InChI | 1S/C17H10O3/c18-9-4-5-10-11-6-7-15(19)12-2-1-3-13(16(11)12)17(20)14(10)8-9/h1-8,18-19H |
| InChIKey | KAMPHOMHWAMCCX-UHFFFAOYSA-N |
| Density | 1.492g/cm3 (Cal.) |
|---|---|
| Boiling point | 553.3°C at 760 mmHg (Cal.) |
| Flash point | 302.485°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,9-Dihydroxy-7H-Benz[de]Anthracen-7-One |