|
CAS#: 69673-89-8 Product: 2-Ethyl-2-Hydroxy-4'-Methylhexanophenone No suppilers available for the product. |
| Name | 2-Ethyl-2-Hydroxy-4'-Methylhexanophenone |
|---|---|
| Synonyms | 2-Ethyl-2-Hydroxy-4'-Methylhexanophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 |
| CAS Registry Number | 69673-89-8 |
| EINECS | 274-075-5 |
| SMILES | C1=C(C(=O)C(O)(CCCC)CC)C=CC(=C1)C |
| InChI | 1S/C15H22O2/c1-4-6-11-15(17,5-2)14(16)13-9-7-12(3)8-10-13/h7-10,17H,4-6,11H2,1-3H3 |
| InChIKey | KKGBAKRMAXRYGR-UHFFFAOYSA-N |
| Density | 1.002g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.471°C at 760 mmHg (Cal.) |
| Flash point | 148.452°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-2-Hydroxy-4'-Methylhexanophenone |