|
CAS#: 6968-62-3 Product: alpha,beta-Glucooctanoic gamma-Lactone No suppilers available for the product. |
| Name | alpha,beta-Glucooctanoic gamma-Lactone |
|---|---|
| Synonyms | 3,4-Dihydroxy-5-(1,2,3,4-Tetrahydroxybutyl)-2-Tetrahydrofuranone; Nsc1678; Nci60_001334 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14O8 |
| Molecular Weight | 238.19 |
| CAS Registry Number | 6968-62-3 |
| EINECS | 230-185-5 |
| SMILES | C(C(C(C(C1C(C(O)C(O1)=O)O)O)O)O)O |
| InChI | 1S/C8H14O8/c9-1-2(10)3(11)4(12)7-5(13)6(14)8(15)16-7/h2-7,9-14H,1H2 |
| InChIKey | NUYDBDGECBIUPJ-UHFFFAOYSA-N |
| Density | 1.838g/cm3 (Cal.) |
|---|---|
| Boiling point | 620.214°C at 760 mmHg (Cal.) |
| Flash point | 250.891°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha,beta-Glucooctanoic gamma-Lactone |