Online Database of Chemicals from Around the World
|
CAS#: 6971-20-6 Product: (E)-1-(2-Hydroxy-3,4,6-Trimethoxy-Phenyl)-3-Phenyl-Prop-2-En-1-One No suppilers available for the product. |
| Name | (E)-1-(2-Hydroxy-3,4,6-Trimethoxy-Phenyl)-3-Phenyl-Prop-2-En-1-One |
|---|---|
| Synonyms | 1-(2-Hydroxy-3,4,6-Trimethoxyphenyl)-3-Phenylprop-2-En-1-One; (E)-1-(2-Hydroxy-3,4,6-Trimethoxy-Phenyl)-3-Phenyl-Prop-2-En-1-One; 1-(2-Hydroxy-3,4,6-Trimethoxy-Phenyl)-3-Phenyl-Prop-2-En-1-One |
| Molecular Structure |  |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 |
| CAS Registry Number | 6971-20-6 |
| SMILES | C1=C(OC)C(=C(C(=C1OC)C(/C=C/C2=CC=CC=C2)=O)O)OC |
| InChI | 1S/C18H18O5/c1-21-14-11-15(22-2)18(23-3)17(20)16(14)13(19)10-9-12-7-5-4-6-8-12/h4-11,20H,1-3H3/b10-9+ |
| InChIKey | OCGIXADHTXAPKN-MDZDMXLPSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 529.857°C at 760 mmHg (Cal.) |
| Flash point | 193.222°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-1-(2-Hydroxy-3,4,6-Trimethoxy-Phenyl)-3-Phenyl-Prop-2-En-1-One |