|
CAS#: 69738-55-2 Product: Methyl 4-Chloro-4-(Methoxyimino)-3-Oxobutyrate No suppilers available for the product. |
| Name | Methyl 4-Chloro-4-(Methoxyimino)-3-Oxobutyrate |
|---|---|
| Synonyms | Methyl (4Z)-4-Chloro-4-Methoxyimino-3-Oxo-Butanoate; (4Z)-4-Chloro-4-Methoxyimino-3-Oxobutanoic Acid Methyl Ester; (4Z)-4-Chloro-3-Keto-4-Methoxyimino-Butyric Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8ClNO4 |
| Molecular Weight | 193.59 |
| CAS Registry Number | 69738-55-2 |
| EINECS | 274-101-5 |
| SMILES | C(C(=O)/C(Cl)=N/OC)C(OC)=O |
| InChI | 1S/C6H8ClNO4/c1-11-5(10)3-4(9)6(7)8-12-2/h3H2,1-2H3/b8-6- |
| InChIKey | ZNMFQLZPKMZNBR-VURMDHGXSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 246.167°C at 760 mmHg (Cal.) |
| Flash point | 102.678°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-Chloro-4-(Methoxyimino)-3-Oxobutyrate |