Online Database of Chemicals from Around the World
|
CAS#: 69745-81-9 Product: 4-Hydroxy-6,10-dimethyl-3-methylene-2-oxo-2,3,3a,4,5,8,9,11a-octahydrocyclodeca[b]furan-9-yl acetate No suppilers available for the product. |
| Name | 4-Hydroxy-6,10-dimethyl-3-methylene-2-oxo-2,3,3a,4,5,8,9,11a-octahydrocyclodeca[b]furan-9-yl acetate |
|---|---|
| Molecular Structure | ![CAS#: 69745-81-9, 4-Hydroxy-6,10-dimethyl-3-methylene-2-oxo-2,3,3a,4,5,8,9,11a-octahydrocyclodeca[b]furan-9-yl acetate](/moreStructures/69745-81-9.gif) |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.35 |
| CAS Registry Number | 69745-81-9 |
| SMILES | O=C/1OC2C=C(C(OC(=O)C)CC=C(CC(O)C2C\1=C)C)C |
| InChI | 1S/C17H22O5/c1-9-5-6-14(21-12(4)18)10(2)8-15-16(13(19)7-9)11(3)17(20)22-15/h5,8,13-16,19H,3,6-7H2,1-2,4H3 |
| InChIKey | UYVDDCCDZKMLBM-UHFFFAOYSA-N |
| Density | 1.184g/cm3 (Cal.) |
|---|---|
| Boiling point | 485.406°C at 760 mmHg (Cal.) |
| Flash point | 175.025°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Hydroxy-6,10-dimethyl-3-methylene-2-oxo-2,3,3a,4,5,8,9,11a-octahydrocyclodeca[b]furan-9-yl acetate |