|
CAS#: 6975-48-0 Product: 4-Amino-N-(Cyclopentylideneamino)Benzenesulfonamide No suppilers available for the product. |
| Name | 4-Amino-N-(Cyclopentylideneamino)Benzenesulfonamide |
|---|---|
| Synonyms | Nsc22607 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.32 |
| CAS Registry Number | 6975-48-0 |
| SMILES | C1=CC(=CC=C1[S](NN=C2CCCC2)(=O)=O)N |
| InChI | 1S/C11H15N3O2S/c12-9-5-7-11(8-6-9)17(15,16)14-13-10-3-1-2-4-10/h5-8,14H,1-4,12H2 |
| InChIKey | WIRPQCKCBLLWCC-UHFFFAOYSA-N |
| Density | 1.414g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.876°C at 760 mmHg (Cal.) |
| Flash point | 228.901°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-N-(Cyclopentylideneamino)Benzenesulfonamide |