|
CAS#: 69792-62-7 Product: N,N,-Dimethylchlorphentermine No suppilers available for the product. |
| Name | N,N,-Dimethylchlorphentermine |
|---|---|
| Synonyms | 1-(4-Chlorophenyl)-N,N,2-Trimethyl-Propan-2-Amine; [2-(4-Chlorophenyl)-1,1-Dimethyl-Ethyl]-Dimethyl-Amine; Benzeneethanamine, 4-Chloro-N,N,Alpha,Alpha-Tetramethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.73 |
| CAS Registry Number | 69792-62-7 |
| SMILES | C1=CC(=CC=C1CC(N(C)C)(C)C)Cl |
| InChI | 1S/C12H18ClN/c1-12(2,14(3)4)9-10-5-7-11(13)8-6-10/h5-8H,9H2,1-4H3 |
| InChIKey | RDYPGOZOMNSFPB-UHFFFAOYSA-N |
| Density | 1.02g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.801°C at 760 mmHg (Cal.) |
| Flash point | 115.157°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N,-Dimethylchlorphentermine |