|
CAS#: 69915-35-1 Product: 1-Thione-9-Methylamino-Phenalene No suppilers available for the product. |
| Name | 1-Thione-9-Methylamino-Phenalene |
|---|---|
| Synonyms | 9-Methylamino-1-Phenalenethione; Phenalene-1-Thione, 9-Methylamino-; Phenalene,1-Thione-9-Methylamino- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11NS |
| Molecular Weight | 225.31 |
| CAS Registry Number | 69915-35-1 |
| SMILES | C1=CC(=C3C2=C1C=CC=C2C=CC3=S)NC |
| InChI | 1S/C14H11NS/c1-15-11-7-5-9-3-2-4-10-6-8-12(16)14(11)13(9)10/h2-8,15H,1H3 |
| InChIKey | JCMOREHIFWKKHE-UHFFFAOYSA-N |
| Density | 1.278g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.443°C at 760 mmHg (Cal.) |
| Flash point | 212.915°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Thione-9-Methylamino-Phenalene |