|
CAS#: 69938-81-4 Product: 2,2-Dimethyl-1,3-propanediyl bis(2-hydroxybenzoate) No suppilers available for the product. |
| Name | 2,2-Dimethyl-1,3-propanediyl bis(2-hydroxybenzoate) |
|---|---|
| Synonyms | 2,2-dimethyl-1,3-propanediyl disalicylate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 |
| CAS Registry Number | 69938-81-4 |
| EINECS | 274-228-6 |
| SMILES | O=C(OCC(C)(C)COC(=O)c1ccccc1O)c2ccccc2O |
| InChI | 1S/C19H20O6/c1-19(2,11-24-17(22)13-7-3-5-9-15(13)20)12-25-18(23)14-8-4-6-10-16(14)21/h3-10,20-21H,11-12H2,1-2H3 |
| InChIKey | UPOAXWJOHRPRER-UHFFFAOYSA-N |
| Density | 1.263g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.634°C at 760 mmHg (Cal.) |
| Flash point | 166.388°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dimethyl-1,3-propanediyl bis(2-hydroxybenzoate) |