|
CAS#: 69956-77-0 Product: Pelubiprofen No suppilers available for the product. |
| Name | Pelubiprofen |
|---|---|
| Synonyms | 2-[4-[(E)-(2-Ketocyclohexylidene)Methyl]Phenyl]Propionic Acid; D01865; Pelubiprofen |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 |
| CAS Registry Number | 69956-77-0 |
| SMILES | C1=CC(=CC=C1\C=C/2C(CCCC2)=O)C(C(O)=O)C |
| InChI | 1S/C16H18O3/c1-11(16(18)19)13-8-6-12(7-9-13)10-14-4-2-3-5-15(14)17/h6-11H,2-5H2,1H3,(H,18,19)/b14-10+ |
| InChIKey | AUZUGWXLBGZUPP-GXDHUFHOSA-N |
| Density | 1.199g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.358°C at 760 mmHg (Cal.) |
| Flash point | 244.525°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pelubiprofen |