|
CAS#: 70020-66-5 Product: 4'-Acetyl-3-[Bis(2-Chloroethyl)Amino]-4-Methylbenzanilide No suppilers available for the product. |
| Name | 4'-Acetyl-3-[Bis(2-Chloroethyl)Amino]-4-Methylbenzanilide |
|---|---|
| Synonyms | N-(4-Acetylphenyl)-3-[Bis(2-Chloroethyl)Amino]-4-Methyl-Benzamide; 3-[Bis(2-Chloroethyl)Amino]-N-(4-Ethanoylphenyl)-4-Methyl-Benzamide; 4'-Acetyl-3-(Bis(2-Chloroethyl)Amino)-4-Methylbenzanilide |
| Molecular Structure | ![]() |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 |
| CAS Registry Number | 70020-66-5 |
| SMILES | C1=C(N(CCCl)CCCl)C(=CC=C1C(NC2=CC=C(C=C2)C(C)=O)=O)C |
| InChI | 1S/C20H22Cl2N2O2/c1-14-3-4-17(13-19(14)24(11-9-21)12-10-22)20(26)23-18-7-5-16(6-8-18)15(2)25/h3-8,13H,9-12H2,1-2H3,(H,23,26) |
| InChIKey | ORMZGQTVBNLWDY-UHFFFAOYSA-N |
| Density | 1.269g/cm3 (Cal.) |
|---|---|
| Boiling point | 507.917°C at 760 mmHg (Cal.) |
| Flash point | 260.979°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Acetyl-3-[Bis(2-Chloroethyl)Amino]-4-Methylbenzanilide |