|
CAS#: 7008-24-4 Product: Chloroserpidine No suppilers available for the product. |
| Name | Chloroserpidine |
|---|---|
| Synonyms | 3-Beta,20-Alpha-Yohimban-16-Beta-Carboxylic Acid, 10-Chloro-18-Beta-Hydroxy-17-Alpha-Methoxy-, Methyl Ester, 3,4,5-Trimethoxybenzoate (Ester); 4-25-00-01284 (Beilstein Handbook Reference); Brn 0073937 |
| Molecular Structure | ![]() |
| Molecular Formula | C32H37ClN2O8 |
| Molecular Weight | 613.11 |
| CAS Registry Number | 7008-24-4 |
| SMILES | [C@@H]36C2=C(C1=CC(=CC=C1[NH]2)Cl)CCN3C[C@H]5C[C@@H](OC(C4=CC(=C(C(=C4)OC)OC)OC)=O)[C@@H]([C@H]([C@H]5C6)C(OC)=O)OC |
| InChI | 1S/C32H37ClN2O8/c1-38-24-10-16(11-25(39-2)29(24)40-3)31(36)43-26-12-17-15-35-9-8-19-21-13-18(33)6-7-22(21)34-28(19)23(35)14-20(17)27(30(26)41-4)32(37)42-5/h6-7,10-11,13,17,20,23,26-27,30,34H,8-9,12,14-15H2,1-5H3/t17-,20+,23-,26-,27+,30+/m1/s1 |
| InChIKey | FQUMWACBNIURCJ-RWZVGCGMSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 695.689°C at 760 mmHg (Cal.) |
| Flash point | 374.539°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chloroserpidine |