|
CAS#: 70144-71-7 Product: Cbz-Lys-Pna No suppilers available for the product. |
| Name | Cbz-Lys-Pna |
|---|---|
| Synonyms | Phenylmethyl N-[(1S)-5-Amino-1-[(4-Nitrophenyl)Carbamoyl]Pentyl]Carbamate; N-[(1S)-5-Amino-1-[[(4-Nitrophenyl)Amino]-Oxomethyl]Pentyl]Carbamic Acid Phenylmethyl Ester; N-[(1S)-5-Amino-1-[(4-Nitrophenyl)Carbamoyl]Pentyl]Carbamic Acid Benzyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.43 |
| CAS Registry Number | 70144-71-7 |
| SMILES | [C@@H](NC(OCC1=CC=CC=C1)=O)(C(=O)NC2=CC=C([N+]([O-])=O)C=C2)CCCCN |
| InChI | 1S/C20H24N4O5/c21-13-5-4-8-18(23-20(26)29-14-15-6-2-1-3-7-15)19(25)22-16-9-11-17(12-10-16)24(27)28/h1-3,6-7,9-12,18H,4-5,8,13-14,21H2,(H,22,25)(H,23,26)/t18-/m0/s1 |
| InChIKey | FKFJWYPXPIUVGU-SFHVURJKSA-N |
| Density | 1.29g/cm3 (Cal.) |
|---|---|
| Boiling point | 670.798°C at 760 mmHg (Cal.) |
| Flash point | 359.486°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cbz-Lys-Pna |