|
CAS#: 70172-42-8 Product: N-Phenylacetoaminomethylene-DL-p-nitrophenylalanine No suppilers available for the product. |
| Name | N-Phenylacetoaminomethylene-DL-p-nitrophenylalanine |
|---|---|
| Synonyms | (2S)-3-(4-Nitrophenyl)-2-[[(1-Oxo-2-Phenylethyl)Amino]Methylamino]Propanoic Acid; (2S)-3-(4-Nitrophenyl)-2-[[(2-Phenylacetyl)Amino]Methylamino]Propionic Acid; (2S)-3-(4-Nitrophenyl)-2-[(2-Phenylethanoylamino)Methylamino]Propanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 |
| CAS Registry Number | 70172-42-8 |
| SMILES | [C@H](NCNC(=O)CC1=CC=CC=C1)(CC2=CC=C([N+]([O-])=O)C=C2)C(=O)O |
| InChI | 1S/C18H19N3O5/c22-17(11-13-4-2-1-3-5-13)20-12-19-16(18(23)24)10-14-6-8-15(9-7-14)21(25)26/h1-9,16,19H,10-12H2,(H,20,22)(H,23,24)/t16-/m0/s1 |
| InChIKey | MALANEHOOMRDSZ-INIZCTEOSA-N |
| Density | 1.321g/cm3 (Cal.) |
|---|---|
| Boiling point | 647.266°C at 760 mmHg (Cal.) |
| Flash point | 345.254°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Phenylacetoaminomethylene-DL-p-nitrophenylalanine |