|
CAS#: 70190-72-6 Product: 2,4-Dichlorobenzoic Acid Chloromethyl Ester No suppilers available for the product. |
| Name | 2,4-Dichlorobenzoic Acid Chloromethyl Ester |
|---|---|
| Synonyms | 2,4-Dichlorobenzoic Acid Chloromethyl Ester; Nsc221226; Wln: G1ovr Bg Dg |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Cl3O2 |
| Molecular Weight | 239.49 |
| CAS Registry Number | 70190-72-6 |
| SMILES | C1=CC(=CC(=C1C(OCCl)=O)Cl)Cl |
| InChI | 1S/C8H5Cl3O2/c9-4-13-8(12)6-2-1-5(10)3-7(6)11/h1-3H,4H2 |
| InChIKey | DOIDCVLQRFSVNF-UHFFFAOYSA-N |
| Density | 1.473g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.008°C at 760 mmHg (Cal.) |
| Flash point | 143.041°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dichlorobenzoic Acid Chloromethyl Ester |