| Name | Bis(2-Hydroxyethyl)Ammonium 1,1,2,2,3,3,4,4,5,5,5-Undecafluoropentane-1-Sulphonate |
|---|---|
| Synonyms | 1-Pentanesulfonic Acid, 1,1,2,2,3,3,4,4,5,5,5-Undecafluoro-, Compd. With 2,2'-Iminobis(Ethanol) (1:1); 1-Pentanesulfonic Acid, 1,1,2,2,3,3,4,4,5,5,5-Undecafluoro-, Compdwith 2,2'-Iminobis(Ethanol) (1:1); Bis(2-Hydroxyethyl)Ammonium 1,1,2,2,3,3,4,4,5,5,5-Undecafluoropentane-1-Sulphonate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12F11NO5S |
| Molecular Weight | 455.24 |
| CAS Registry Number | 70225-17-1 |
| EINECS | 274-463-4 |
| SMILES | O=[S](=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.C(NCCO)CO |
| InChI | 1S/C5HF11O3S.C4H11NO2/c6-1(7,2(8,9)4(12,13)14)3(10,11)5(15,16)20(17,18)19;6-3-1-5-2-4-7/h(H,17,18,19);5-7H,1-4H2 |
| InChIKey | YCMYOAOBWUIFST-UHFFFAOYSA-N |
| Boiling point | 418.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 207.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2-Hydroxyethyl)Ammonium 1,1,2,2,3,3,4,4,5,5,5-Undecafluoropentane-1-Sulphonate |