Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-[(Dimethylamino)methyl]-3-ethyl-1(2H)-isoquinolinone |
|---|---|
| Synonyms | 4-((dimethylamino)methyl)-3-ethylisoquinolin-1(2H)-one |
| Molecular Structure | ![CAS#: 702707-76-4, 4-[(Dimethylamino)methyl]-3-ethyl-1(2H)-isoquinolinone](/moreStructures/702707-76-4.gif) |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 |
| CAS Registry Number | 702707-76-4 |
| SMILES | CN(C)C\C1=C(/CC)NC(=O)c2ccccc12 |
| InChI | 1S/C14H18N2O/c1-4-13-12(9-16(2)3)10-7-5-6-8-11(10)14(17)15-13/h5-8H,4,9H2,1-3H3,(H,15,17) |
| InChIKey | DOKFFQBBXTWYCG-UHFFFAOYSA-N |
| Density | 1.061g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.592°C at 760 mmHg (Cal.) |
| Flash point | 197.886°C (Cal.) |
| Refractive index | 1.544 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(Dimethylamino)methyl]-3-ethyl-1(2H)-isoquinolinone |