| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | Nemonapride |
|---|---|
| Synonyms | 5-Chloro-2-Methoxy-4-Methylamino-N-[2-Methyl-1-(Phenylmethyl)-3-Pyrrolidinyl]Benzamide; N-[1-(Benzyl)-2-Methyl-Pyrrolidin-3-Yl]-5-Chloro-2-Methoxy-4-Methylamino-Benzamide; 5-Chloro-2-Methoxy-4-(Methylamino)-N-(2-Methyl-1-(Phenylmethyl)-3-Pyrrolidinyl)Benzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 |
| CAS Registry Number | 70325-83-6 |
| SMILES | C1=C(C(=CC(=C1Cl)NC)OC)C(NC3C(N(CC2=CC=CC=C2)CC3)C)=O |
| InChI | 1S/C21H26ClN3O2/c1-14-18(9-10-25(14)13-15-7-5-4-6-8-15)24-21(26)16-11-17(22)19(23-2)12-20(16)27-3/h4-8,11-12,14,18,23H,9-10,13H2,1-3H3,(H,24,26) |
| InChIKey | KRVOJOCLBAAKSJ-UHFFFAOYSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 514.941°C at 760 mmHg (Cal.) |
| Flash point | 265.227°C (Cal.) |
| solubility | Soluble to 20 mM in ethanol and to 25 mM in DMSO |
| Market Analysis Reports |
| List of Reports Available for Nemonapride |